C15H22F3N5O — CID 95302743
2-[[(6S)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]-N-[4-(trifluoromethyl)cyclohexyl]acetamide (PubChem CID 95302743) has the molecular formula C15H22F3N5O and a molecular weight of 345.37 g/mol. Its IUPAC name is 2-[[(6S)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]-N-[4-(trifluoromethyl)cyclohexyl]acetamide.
| Compound Name | 2-[[(6S)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]-N-[4-(trifluoromethyl)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 95302743 |
| Molecular Formula | C15H22F3N5O |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 2-[[(6S)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]-N-[4-(trifluoromethyl)cyclohexyl]acetamide |
| SMILES | O=C(CN[C@H]1CCc2ncnn2C1)NC1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H22F3N5O/c16-15(17,18)10-1-3-11(4-2-10)22-14(24)7-19-12-5-6-13-20-9-21-23(13)8-12/h9-12,19H,1-8H2,(H,22,24)/t10?,11?,12-/m0/s1 |
| InChIKey | GVGHABXNPVVEPU-MCIGGMRASA-N |
| XLogP | 1.42 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |