C18H23N5O — CID 95322900
N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-2-[[(6R)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]acetamide (PubChem CID 95322900) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-2-[[(6R)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]acetamide.
| Compound Name | N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-2-[[(6R)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]acetamide |
|---|---|
| PubChem CID | 95322900 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-2-[[(6R)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]acetamide |
| SMILES | O=C(CN[C@@H]1CCc2ncnn2C1)N[C@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C18H23N5O/c24-18(10-19-14-8-9-17-20-12-21-23(17)11-14)22-16-7-3-5-13-4-1-2-6-15(13)16/h1-2,4,6,12,14,16,19H,3,5,7-11H2,(H,22,24)/t14-,16+/m1/s1 |
| InChIKey | OSROEISDLLEKRQ-ZBFHGGJFSA-N |
| XLogP | 1.38 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |