C18H24N6O — CID 95338996
1-(4-phenylpiperazin-1-yl)-2-[[(6S)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]ethanone (PubChem CID 95338996) has the molecular formula C18H24N6O and a molecular weight of 340.43 g/mol. Its IUPAC name is 1-(4-phenylpiperazin-1-yl)-2-[[(6S)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]ethanone.
| Compound Name | 1-(4-phenylpiperazin-1-yl)-2-[[(6S)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]ethanone |
|---|---|
| PubChem CID | 95338996 |
| Molecular Formula | C18H24N6O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 1-(4-phenylpiperazin-1-yl)-2-[[(6S)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl]amino]ethanone |
| SMILES | O=C(CN[C@H]1CCc2ncnn2C1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C18H24N6O/c25-18(12-19-15-6-7-17-20-14-21-24(17)13-15)23-10-8-22(9-11-23)16-4-2-1-3-5-16/h1-5,14-15,19H,6-13H2/t15-/m0/s1 |
| InChIKey | NZMFKRZFISMUKJ-HNNXBMFYSA-N |
| XLogP | 0.53 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |