C15H17N7 — CID 95313962
(6R)-N-[(1-phenyltriazol-4-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 95313962) has the molecular formula C15H17N7 and a molecular weight of 295.35 g/mol. Its IUPAC name is (6R)-N-[(1-phenyltriazol-4-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | (6R)-N-[(1-phenyltriazol-4-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 95313962 |
| Molecular Formula | C15H17N7 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | (6R)-N-[(1-phenyltriazol-4-yl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | c1ccc(-n2cc(CN[C@@H]3CCc4ncnn4C3)nn2)cc1 |
| InChI | InChI=1S/C15H17N7/c1-2-4-14(5-3-1)21-10-13(19-20-21)8-16-12-6-7-15-17-11-18-22(15)9-12/h1-5,10-12,16H,6-9H2/t12-/m1/s1 |
| InChIKey | FNWAPGGWRPEWRF-GFCCVEGCSA-N |
| XLogP | 0.96 |
| TPSA | 73.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |