C19H20N4 — CID 95291237
(6R)-N-[(4-phenylphenyl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 95291237) has the molecular formula C19H20N4 and a molecular weight of 304.40 g/mol. Its IUPAC name is (6R)-N-[(4-phenylphenyl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | (6R)-N-[(4-phenylphenyl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 95291237 |
| Molecular Formula | C19H20N4 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | (6R)-N-[(4-phenylphenyl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | c1ccc(-c2ccc(CN[C@@H]3CCc4ncnn4C3)cc2)cc1 |
| InChI | InChI=1S/C19H20N4/c1-2-4-16(5-3-1)17-8-6-15(7-9-17)12-20-18-10-11-19-21-14-22-23(19)13-18/h1-9,14,18,20H,10-13H2/t18-/m1/s1 |
| InChIKey | WLYMTVPGTQDTAS-GOSISDBHSA-N |
| XLogP | 3.05 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |