C18H22N6O — CID 95303181
(6S)-N-[[4-[(1-methylimidazol-2-yl)methoxy]phenyl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 95303181) has the molecular formula C18H22N6O and a molecular weight of 338.42 g/mol. Its IUPAC name is (6S)-N-[[4-[(1-methylimidazol-2-yl)methoxy]phenyl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | (6S)-N-[[4-[(1-methylimidazol-2-yl)methoxy]phenyl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 95303181 |
| Molecular Formula | C18H22N6O |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | (6S)-N-[[4-[(1-methylimidazol-2-yl)methoxy]phenyl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | Cn1ccnc1COc1ccc(CN[C@H]2CCc3ncnn3C2)cc1 |
| InChI | InChI=1S/C18H22N6O/c1-23-9-8-19-18(23)12-25-16-5-2-14(3-6-16)10-20-15-4-7-17-21-13-22-24(17)11-15/h2-3,5-6,8-9,13,15,20H,4,7,10-12H2,1H3/t15-/m0/s1 |
| InChIKey | FCDFXZLPEMIHMW-HNNXBMFYSA-N |
| XLogP | 1.70 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |