C10H13N5S — CID 115732375
N-(1,3-thiazol-5-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 115732375) has the molecular formula C10H13N5S and a molecular weight of 235.32 g/mol. Its IUPAC name is N-(1,3-thiazol-5-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | N-(1,3-thiazol-5-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 115732375 |
| Molecular Formula | C10H13N5S |
| Molecular Weight | 235.32 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | N-(1,3-thiazol-5-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | c1nc2n(n1)CC(NCc1cncs1)CC2 |
| InChI | InChI=1S/C10H13N5S/c1-2-10-13-6-14-15(10)5-8(1)12-4-9-3-11-7-16-9/h3,6-8,12H,1-2,4-5H2 |
| InChIKey | AGFCLTLKJIQMEE-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.32 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |