C14H17NO2S3 — CID 43778670
1,1-dioxo-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]thian-4-amine (PubChem CID 43778670) has the molecular formula C14H17NO2S3 and a molecular weight of 327.50 g/mol. Its IUPAC name is 1,1-dioxo-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]thian-4-amine.
| Compound Name | 1,1-dioxo-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]thian-4-amine |
|---|---|
| PubChem CID | 43778670 |
| Molecular Formula | C14H17NO2S3 |
| Molecular Weight | 327.50 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 1,1-dioxo-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]thian-4-amine |
| SMILES | O=S1(=O)CCC(NCc2cc(-c3cccs3)cs2)CC1 |
| InChI | InChI=1S/C14H17NO2S3/c16-20(17)6-3-12(4-7-20)15-9-13-8-11(10-19-13)14-2-1-5-18-14/h1-2,5,8,10,12,15H,3-4,6-7,9H2 |
| InChIKey | SDJHZDYWODMJMY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |