C11H17NO2S2 — CID 43614827
N-[(5-methylthiophen-2-yl)methyl]-1,1-dioxothian-4-amine (PubChem CID 43614827) has the molecular formula C11H17NO2S2 and a molecular weight of 259.40 g/mol. Its IUPAC name is N-[(5-methylthiophen-2-yl)methyl]-1,1-dioxothian-4-amine.
| Compound Name | N-[(5-methylthiophen-2-yl)methyl]-1,1-dioxothian-4-amine |
|---|---|
| PubChem CID | 43614827 |
| Molecular Formula | C11H17NO2S2 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | N-[(5-methylthiophen-2-yl)methyl]-1,1-dioxothian-4-amine |
| SMILES | Cc1ccc(CNC2CCS(=O)(=O)CC2)s1 |
| InChI | InChI=1S/C11H17NO2S2/c1-9-2-3-11(15-9)8-12-10-4-6-16(13,14)7-5-10/h2-3,10,12H,4-8H2,1H3 |
| InChIKey | ZXROBDPKFYFQIY-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |