C12H21ClN2O2S2 — CID 47030573
1-methylsulfonyl-N-[(5-methylthiophen-2-yl)methyl]piperidin-4-amine;hydrochloride (PubChem CID 47030573) has the molecular formula C12H21ClN2O2S2 and a molecular weight of 324.90 g/mol. Its IUPAC name is 1-methylsulfonyl-N-[(5-methylthiophen-2-yl)methyl]piperidin-4-amine;hydrochloride.
| Compound Name | 1-methylsulfonyl-N-[(5-methylthiophen-2-yl)methyl]piperidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 47030573 |
| Molecular Formula | C12H21ClN2O2S2 |
| Molecular Weight | 324.90 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 1-methylsulfonyl-N-[(5-methylthiophen-2-yl)methyl]piperidin-4-amine;hydrochloride |
| SMILES | Cc1ccc(CNC2CCN(S(C)(=O)=O)CC2)s1.Cl |
| InChI | InChI=1S/C12H20N2O2S2.ClH/c1-10-3-4-12(17-10)9-13-11-5-7-14(8-6-11)18(2,15)16;/h3-4,11,13H,5-9H2,1-2H3;1H |
| InChIKey | NTIGUEBDYUWYRG-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.90 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |