C9H14ClNS — CID 17294982
N-[(5-methylthiophen-2-yl)methyl]cyclopropanamine;hydrochloride (PubChem CID 17294982) has the molecular formula C9H14ClNS and a molecular weight of 203.74 g/mol. Its IUPAC name is N-[(5-methylthiophen-2-yl)methyl]cyclopropanamine;hydrochloride.
| Compound Name | N-[(5-methylthiophen-2-yl)methyl]cyclopropanamine;hydrochloride |
|---|---|
| PubChem CID | 17294982 |
| Molecular Formula | C9H14ClNS |
| Molecular Weight | 203.74 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | N-[(5-methylthiophen-2-yl)methyl]cyclopropanamine;hydrochloride |
| SMILES | Cc1ccc(CNC2CC2)s1.Cl |
| InChI | InChI=1S/C9H13NS.ClH/c1-7-2-5-9(11-7)6-10-8-3-4-8;/h2,5,8,10H,3-4,6H2,1H3;1H |
| InChIKey | VQIKTYPXIUXBTD-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.74 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |