C11H15NS — CID 115696592
N-[(5-methylthiophen-2-yl)methyl]cyclopent-3-en-1-amine (PubChem CID 115696592) has the molecular formula C11H15NS and a molecular weight of 193.31 g/mol. Its IUPAC name is N-[(5-methylthiophen-2-yl)methyl]cyclopent-3-en-1-amine.
| Compound Name | N-[(5-methylthiophen-2-yl)methyl]cyclopent-3-en-1-amine |
|---|---|
| PubChem CID | 115696592 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | N-[(5-methylthiophen-2-yl)methyl]cyclopent-3-en-1-amine |
| SMILES | Cc1ccc(CNC2CC=CC2)s1 |
| InChI | InChI=1S/C11H15NS/c1-9-6-7-11(13-9)8-12-10-4-2-3-5-10/h2-3,6-7,10,12H,4-5,8H2,1H3 |
| InChIKey | WOVMYZUEZNDYDS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|