C14H24N2O2S2 — CID 62346420
1-ethylsulfonyl-N-[(5-ethylthiophen-2-yl)methyl]piperidin-4-amine (PubChem CID 62346420) has the molecular formula C14H24N2O2S2 and a molecular weight of 316.49 g/mol. Its IUPAC name is 1-ethylsulfonyl-N-[(5-ethylthiophen-2-yl)methyl]piperidin-4-amine.
| Compound Name | 1-ethylsulfonyl-N-[(5-ethylthiophen-2-yl)methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 62346420 |
| Molecular Formula | C14H24N2O2S2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 1-ethylsulfonyl-N-[(5-ethylthiophen-2-yl)methyl]piperidin-4-amine |
| SMILES | CCc1ccc(CNC2CCN(S(=O)(=O)CC)CC2)s1 |
| InChI | InChI=1S/C14H24N2O2S2/c1-3-13-5-6-14(19-13)11-15-12-7-9-16(10-8-12)20(17,18)4-2/h5-6,12,15H,3-4,7-11H2,1-2H3 |
| InChIKey | CERZLHHCMOVIDV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |