C10H14ClNO2S2 — CID 43614830
N-[(5-chlorothiophen-2-yl)methyl]-1,1-dioxothian-4-amine (PubChem CID 43614830) has the molecular formula C10H14ClNO2S2 and a molecular weight of 279.81 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-1,1-dioxothian-4-amine.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-1,1-dioxothian-4-amine |
|---|---|
| PubChem CID | 43614830 |
| Molecular Formula | C10H14ClNO2S2 |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-1,1-dioxothian-4-amine |
| SMILES | O=S1(=O)CCC(NCc2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C10H14ClNO2S2/c11-10-2-1-9(15-10)7-12-8-3-5-16(13,14)6-4-8/h1-2,8,12H,3-7H2 |
| InChIKey | PNJAJRDSSIAGQJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |