C9H14N2O3S — CID 81171423
N-(1,2-oxazol-3-ylmethyl)-1,1-dioxothian-4-amine (PubChem CID 81171423) has the molecular formula C9H14N2O3S and a molecular weight of 230.29 g/mol. Its IUPAC name is N-(1,2-oxazol-3-ylmethyl)-1,1-dioxothian-4-amine.
| Compound Name | N-(1,2-oxazol-3-ylmethyl)-1,1-dioxothian-4-amine |
|---|---|
| PubChem CID | 81171423 |
| Molecular Formula | C9H14N2O3S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | N-(1,2-oxazol-3-ylmethyl)-1,1-dioxothian-4-amine |
| SMILES | O=S1(=O)CCC(NCc2ccon2)CC1 |
| InChI | InChI=1S/C9H14N2O3S/c12-15(13)5-2-8(3-6-15)10-7-9-1-4-14-11-9/h1,4,8,10H,2-3,5-7H2 |
| InChIKey | SSGMARSIHWKARA-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |