About 2-[3-methylbutan-2-yl(1,2-oxazol-3-ylmethyl)amino]ethanesulfonyl fluoride
2-[3-methylbutan-2-yl(1,2-oxazol-3-ylmethyl)amino]ethanesulfonyl fluoride (PubChem CID 154881359) has the molecular formula C11H19FN2O3S
and a molecular weight of 278.35 g/mol. Its IUPAC name is 2-[3-methylbutan-2-yl(1,2-oxazol-3-ylmethyl)amino]ethanesulfonyl fluoride.
Molecular Properties
| Compound Name | 2-[3-methylbutan-2-yl(1,2-oxazol-3-ylmethyl)amino]ethanesulfonyl fluoride |
| PubChem CID | 154881359 |
| Molecular Formula | C11H19FN2O3S |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 2-[3-methylbutan-2-yl(1,2-oxazol-3-ylmethyl)amino]ethanesulfonyl fluoride |
| SMILES | CC(C)C(C)N(CCS(=O)(=O)F)Cc1ccon1 |
| InChI | InChI=1S/C11H19FN2O3S/c1-9(2)10(3)14(5-7-18(12,15)16)8-11-4-6-17-13-11/h4,6,9-10H,5,7-8H2,1-3H3 |
| InChIKey | WTTAYTDESCEDPD-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[3-methylbutan-2-yl(1,2-oxazol-3-ylmethyl)amino]ethanesulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-methylbutan-2-yl(1,2-oxazol-3-ylmethyl)amino]ethanesulfonyl fluoride?
The IUPAC name of 2-[3-methylbutan-2-yl(1,2-oxazol-3-ylmethyl)amino]ethanesulfonyl fluoride (CID 154881359) is 2-[3-methylbutan-2-yl(1,2-oxazol-3-ylmethyl)amino]ethanesulfonyl fluoride.
What is the SMILES notation for 2-[3-methylbutan-2-yl(1,2-oxazol-3-ylmethyl)amino]ethanesulfonyl fluoride?
The canonical SMILES for 2-[3-methylbutan-2-yl(1,2-oxazol-3-ylmethyl)amino]ethanesulfonyl fluoride is CC(C)C(C)N(CCS(=O)(=O)F)Cc1ccon1.
What is the InChIKey of 2-[3-methylbutan-2-yl(1,2-oxazol-3-ylmethyl)amino]ethanesulfonyl fluoride?
The InChIKey is WTTAYTDESCEDPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19FN2O3S/c1-9(2)10(3)14(5-7-18(12,15)16)8-11-4-6-17-13-11/h4,6,9-10H,5,7-8H2,1-3H3.
What are the key properties of 2-[3-methylbutan-2-yl(1,2-oxazol-3-ylmethyl)amino]ethanesulfonyl fluoride?
2-[3-methylbutan-2-yl(1,2-oxazol-3-ylmethyl)amino]ethanesulfonyl fluoride has a molecular weight of 278.35 g/mol, XLogP of 1.82, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-methylbutan-2-yl(1,2-oxazol-3-ylmethyl)amino]ethanesulfonyl fluoride is sourced from PubChem (CID 154881359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).