C10H16N2O2S2 — CID 60941990
N-[(2-methyl-1,3-thiazol-5-yl)methyl]-1,1-dioxothian-4-amine (PubChem CID 60941990) has the molecular formula C10H16N2O2S2 and a molecular weight of 260.38 g/mol. Its IUPAC name is N-[(2-methyl-1,3-thiazol-5-yl)methyl]-1,1-dioxothian-4-amine.
| Compound Name | N-[(2-methyl-1,3-thiazol-5-yl)methyl]-1,1-dioxothian-4-amine |
|---|---|
| PubChem CID | 60941990 |
| Molecular Formula | C10H16N2O2S2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | N-[(2-methyl-1,3-thiazol-5-yl)methyl]-1,1-dioxothian-4-amine |
| SMILES | Cc1ncc(CNC2CCS(=O)(=O)CC2)s1 |
| InChI | InChI=1S/C10H16N2O2S2/c1-8-11-6-10(15-8)7-12-9-2-4-16(13,14)5-3-9/h6,9,12H,2-5,7H2,1H3 |
| InChIKey | ZHAAWCAAACHKJX-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |