C8H12N2OS — CID 63622731
N-[(2-methyl-1,3-thiazol-5-yl)methyl]oxetan-3-amine (PubChem CID 63622731) has the molecular formula C8H12N2OS and a molecular weight of 184.26 g/mol. Its IUPAC name is N-[(2-methyl-1,3-thiazol-5-yl)methyl]oxetan-3-amine.
| Compound Name | N-[(2-methyl-1,3-thiazol-5-yl)methyl]oxetan-3-amine |
|---|---|
| PubChem CID | 63622731 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | N-[(2-methyl-1,3-thiazol-5-yl)methyl]oxetan-3-amine |
| SMILES | Cc1ncc(CNC2COC2)s1 |
| InChI | InChI=1S/C8H12N2OS/c1-6-9-2-8(12-6)3-10-7-4-11-5-7/h2,7,10H,3-5H2,1H3 |
| InChIKey | AIISZRAJVOFHJE-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |