C9H14N2S2 — CID 61280795
N-[(2-methyl-1,3-thiazol-5-yl)methyl]thiolan-3-amine (PubChem CID 61280795) has the molecular formula C9H14N2S2 and a molecular weight of 214.36 g/mol. Its IUPAC name is N-[(2-methyl-1,3-thiazol-5-yl)methyl]thiolan-3-amine.
| Compound Name | N-[(2-methyl-1,3-thiazol-5-yl)methyl]thiolan-3-amine |
|---|---|
| PubChem CID | 61280795 |
| Molecular Formula | C9H14N2S2 |
| Molecular Weight | 214.36 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | N-[(2-methyl-1,3-thiazol-5-yl)methyl]thiolan-3-amine |
| SMILES | Cc1ncc(CNC2CCSC2)s1 |
| InChI | InChI=1S/C9H14N2S2/c1-7-10-4-9(13-7)5-11-8-2-3-12-6-8/h4,8,11H,2-3,5-6H2,1H3 |
| InChIKey | HWYODOJDSQVZHN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |