C15H19NS3 — CID 103701381
3-methylsulfanyl-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]cyclopentan-1-amine (PubChem CID 103701381) has the molecular formula C15H19NS3 and a molecular weight of 309.52 g/mol. Its IUPAC name is 3-methylsulfanyl-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]cyclopentan-1-amine.
| Compound Name | 3-methylsulfanyl-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 103701381 |
| Molecular Formula | C15H19NS3 |
| Molecular Weight | 309.52 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 3-methylsulfanyl-N-[(4-thiophen-2-ylthiophen-2-yl)methyl]cyclopentan-1-amine |
| SMILES | CSC1CCC(NCc2cc(-c3cccs3)cs2)C1 |
| InChI | InChI=1S/C15H19NS3/c1-17-13-5-4-12(8-13)16-9-14-7-11(10-19-14)15-3-2-6-18-15/h2-3,6-7,10,12-13,16H,4-5,8-9H2,1H3 |
| InChIKey | ZXTVDEQKITZMTQ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.52 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |