C12H18ClNS2 — CID 107166367
N-[(4-chlorothiophen-2-yl)methyl]-3-methylsulfanylcyclohexan-1-amine (PubChem CID 107166367) has the molecular formula C12H18ClNS2 and a molecular weight of 275.87 g/mol. Its IUPAC name is N-[(4-chlorothiophen-2-yl)methyl]-3-methylsulfanylcyclohexan-1-amine.
| Compound Name | N-[(4-chlorothiophen-2-yl)methyl]-3-methylsulfanylcyclohexan-1-amine |
|---|---|
| PubChem CID | 107166367 |
| Molecular Formula | C12H18ClNS2 |
| Molecular Weight | 275.87 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | N-[(4-chlorothiophen-2-yl)methyl]-3-methylsulfanylcyclohexan-1-amine |
| SMILES | CSC1CCCC(NCc2cc(Cl)cs2)C1 |
| InChI | InChI=1S/C12H18ClNS2/c1-15-11-4-2-3-10(6-11)14-7-12-5-9(13)8-16-12/h5,8,10-11,14H,2-4,6-7H2,1H3 |
| InChIKey | MXZJCXMFKNZSNN-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.87 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |