C11H17ClN2S — CID 79420660
N-[(4-chlorothiophen-2-yl)methyl]-1-methylpiperidin-4-amine (PubChem CID 79420660) has the molecular formula C11H17ClN2S and a molecular weight of 244.79 g/mol. Its IUPAC name is N-[(4-chlorothiophen-2-yl)methyl]-1-methylpiperidin-4-amine.
| Compound Name | N-[(4-chlorothiophen-2-yl)methyl]-1-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 79420660 |
| Molecular Formula | C11H17ClN2S |
| Molecular Weight | 244.79 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | N-[(4-chlorothiophen-2-yl)methyl]-1-methylpiperidin-4-amine |
| SMILES | CN1CCC(NCc2cc(Cl)cs2)CC1 |
| InChI | InChI=1S/C11H17ClN2S/c1-14-4-2-10(3-5-14)13-7-11-6-9(12)8-15-11/h6,8,10,13H,2-5,7H2,1H3 |
| InChIKey | MQLDETSQKQFNOB-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.79 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |