C11H17ClN2S — CID 79420437
4-N-[(4-chlorothiophen-2-yl)methyl]cyclohexane-1,4-diamine (PubChem CID 79420437) has the molecular formula C11H17ClN2S and a molecular weight of 244.79 g/mol. Its IUPAC name is 4-N-[(4-chlorothiophen-2-yl)methyl]cyclohexane-1,4-diamine.
| Compound Name | 4-N-[(4-chlorothiophen-2-yl)methyl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 79420437 |
| Molecular Formula | C11H17ClN2S |
| Molecular Weight | 244.79 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 4-N-[(4-chlorothiophen-2-yl)methyl]cyclohexane-1,4-diamine |
| SMILES | NC1CCC(NCc2cc(Cl)cs2)CC1 |
| InChI | InChI=1S/C11H17ClN2S/c12-8-5-11(15-7-8)6-14-10-3-1-9(13)2-4-10/h5,7,9-10,14H,1-4,6,13H2 |
| InChIKey | OVSRRMUJMOGJFB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.79 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |