C14H23BrN2S — CID 54866584
N-[(4-bromothiophen-2-yl)methyl]-1-tert-butylpiperidin-4-amine (PubChem CID 54866584) has the molecular formula C14H23BrN2S and a molecular weight of 331.32 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-1-tert-butylpiperidin-4-amine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-1-tert-butylpiperidin-4-amine |
|---|---|
| PubChem CID | 54866584 |
| Molecular Formula | C14H23BrN2S |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-1-tert-butylpiperidin-4-amine |
| SMILES | CC(C)(C)N1CCC(NCc2cc(Br)cs2)CC1 |
| InChI | InChI=1S/C14H23BrN2S/c1-14(2,3)17-6-4-12(5-7-17)16-9-13-8-11(15)10-18-13/h8,10,12,16H,4-7,9H2,1-3H3 |
| InChIKey | ZNPQDCCFVPZIKU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |