C12H17BrN2S — CID 43123617
N-[(4-bromothiophen-2-yl)methyl]-1-azabicyclo[2.2.2]octan-3-amine (PubChem CID 43123617) has the molecular formula C12H17BrN2S and a molecular weight of 301.25 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-1-azabicyclo[2.2.2]octan-3-amine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-1-azabicyclo[2.2.2]octan-3-amine |
|---|---|
| PubChem CID | 43123617 |
| Molecular Formula | C12H17BrN2S |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-1-azabicyclo[2.2.2]octan-3-amine |
| SMILES | Brc1csc(CNC2CN3CCC2CC3)c1 |
| InChI | InChI=1S/C12H17BrN2S/c13-10-5-11(16-8-10)6-14-12-7-15-3-1-9(12)2-4-15/h5,8-9,12,14H,1-4,6-7H2 |
| InChIKey | QCURZRASGQBOOF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |