C11H14BrNOS — CID 80602675
N-[(4-bromothiophen-2-yl)methyl]-7-oxabicyclo[2.2.1]heptan-2-amine (PubChem CID 80602675) has the molecular formula C11H14BrNOS and a molecular weight of 288.21 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-7-oxabicyclo[2.2.1]heptan-2-amine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-7-oxabicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 80602675 |
| Molecular Formula | C11H14BrNOS |
| Molecular Weight | 288.21 g/mol |
| Exact Mass | 287.00 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-7-oxabicyclo[2.2.1]heptan-2-amine |
| SMILES | Brc1csc(CNC2CC3CCC2O3)c1 |
| InChI | InChI=1S/C11H14BrNOS/c12-7-3-9(15-6-7)5-13-10-4-8-1-2-11(10)14-8/h3,6,8,10-11,13H,1-2,4-5H2 |
| InChIKey | FQJZWHCLNBTDJC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.21 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |