C9H12BrNO2S — CID 130751579
(3S,4R)-4-[(4-bromothiophen-2-yl)methylamino]oxolan-3-ol (PubChem CID 130751579) has the molecular formula C9H12BrNO2S and a molecular weight of 278.17 g/mol. Its IUPAC name is (3S,4R)-4-[(4-bromothiophen-2-yl)methylamino]oxolan-3-ol.
| Compound Name | (3S,4R)-4-[(4-bromothiophen-2-yl)methylamino]oxolan-3-ol |
|---|---|
| PubChem CID | 130751579 |
| Molecular Formula | C9H12BrNO2S |
| Molecular Weight | 278.17 g/mol |
| Exact Mass | 276.98 |
| IUPAC Name | (3S,4R)-4-[(4-bromothiophen-2-yl)methylamino]oxolan-3-ol |
| SMILES | O[C@@H]1COC[C@H]1NCc1cc(Br)cs1 |
| InChI | InChI=1S/C9H12BrNO2S/c10-6-1-7(14-5-6)2-11-8-3-13-4-9(8)12/h1,5,8-9,11-12H,2-4H2/t8-,9-/m1/s1 |
| InChIKey | FPXGFRRVMFNWTN-RKDXNWHRSA-N |
| XLogP | 1.36 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.17 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |