C10H12BrNS — CID 115696389
N-[(4-bromothiophen-2-yl)methyl]cyclopent-3-en-1-amine (PubChem CID 115696389) has the molecular formula C10H12BrNS and a molecular weight of 258.18 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]cyclopent-3-en-1-amine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]cyclopent-3-en-1-amine |
|---|---|
| PubChem CID | 115696389 |
| Molecular Formula | C10H12BrNS |
| Molecular Weight | 258.18 g/mol |
| Exact Mass | 256.99 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]cyclopent-3-en-1-amine |
| SMILES | Brc1csc(CNC2CC=CC2)c1 |
| InChI | InChI=1S/C10H12BrNS/c11-8-5-10(13-7-8)6-12-9-3-1-2-4-9/h1-2,5,7,9,12H,3-4,6H2 |
| InChIKey | QJPDJGLEYHVYIO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.18 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|