C14H18BrFN2 — CID 43199346
N-[(2-bromo-5-fluorophenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine (PubChem CID 43199346) has the molecular formula C14H18BrFN2 and a molecular weight of 313.21 g/mol. Its IUPAC name is N-[(2-bromo-5-fluorophenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine.
| Compound Name | N-[(2-bromo-5-fluorophenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine |
|---|---|
| PubChem CID | 43199346 |
| Molecular Formula | C14H18BrFN2 |
| Molecular Weight | 313.21 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | N-[(2-bromo-5-fluorophenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine |
| SMILES | Fc1ccc(Br)c(CNC2CN3CCC2CC3)c1 |
| InChI | InChI=1S/C14H18BrFN2/c15-13-2-1-12(16)7-11(13)8-17-14-9-18-5-3-10(14)4-6-18/h1-2,7,10,14,17H,3-6,8-9H2 |
| InChIKey | OMDGKWBRVYZPTQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.21 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |