C14H21Cl3N2 — CID 17158962
N-[(2-chlorophenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride (PubChem CID 17158962) has the molecular formula C14H21Cl3N2 and a molecular weight of 323.69 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride.
| Compound Name | N-[(2-chlorophenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride |
|---|---|
| PubChem CID | 17158962 |
| Molecular Formula | C14H21Cl3N2 |
| Molecular Weight | 323.69 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride |
| SMILES | Cl.Cl.Clc1ccccc1CNC1CN2CCC1CC2 |
| InChI | InChI=1S/C14H19ClN2.2ClH/c15-13-4-2-1-3-12(13)9-16-14-10-17-7-5-11(14)6-8-17;;/h1-4,11,14,16H,5-10H2;2*1H |
| InChIKey | GRGDBQKTOHMVJA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.69 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |