C14H20N2O — CID 105364937
2-[(1-azabicyclo[3.2.1]octan-4-ylamino)methyl]phenol (PubChem CID 105364937) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 2-[(1-azabicyclo[3.2.1]octan-4-ylamino)methyl]phenol.
| Compound Name | 2-[(1-azabicyclo[3.2.1]octan-4-ylamino)methyl]phenol |
|---|---|
| PubChem CID | 105364937 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 2-[(1-azabicyclo[3.2.1]octan-4-ylamino)methyl]phenol |
| SMILES | Oc1ccccc1CNC1CCN2CCC1C2 |
| InChI | InChI=1S/C14H20N2O/c17-14-4-2-1-3-11(14)9-15-13-6-8-16-7-5-12(13)10-16/h1-4,12-13,15,17H,5-10H2 |
| InChIKey | XEFZTCWVMBOJSZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|