C12H17NO2 — CID 102734194
2-[[[(1R,2R)-2-hydroxycyclopentyl]amino]methyl]phenol (PubChem CID 102734194) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 2-[[[(1R,2R)-2-hydroxycyclopentyl]amino]methyl]phenol.
| Compound Name | 2-[[[(1R,2R)-2-hydroxycyclopentyl]amino]methyl]phenol |
|---|---|
| PubChem CID | 102734194 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 2-[[[(1R,2R)-2-hydroxycyclopentyl]amino]methyl]phenol |
| SMILES | Oc1ccccc1CN[C@@H]1CCC[C@H]1O |
| InChI | InChI=1S/C12H17NO2/c14-11-6-2-1-4-9(11)8-13-10-5-3-7-12(10)15/h1-2,4,6,10,12-15H,3,5,7-8H2/t10-,12-/m1/s1 |
| InChIKey | PYBCVWXVNMKILQ-ZYHUDNBSSA-N |
| XLogP | 1.40 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|