C13H17Cl2NO — CID 60612644
2-[(2,3-dichlorophenyl)methylamino]cyclohexan-1-ol (PubChem CID 60612644) has the molecular formula C13H17Cl2NO and a molecular weight of 274.19 g/mol. Its IUPAC name is 2-[(2,3-dichlorophenyl)methylamino]cyclohexan-1-ol.
| Compound Name | 2-[(2,3-dichlorophenyl)methylamino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 60612644 |
| Molecular Formula | C13H17Cl2NO |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 2-[(2,3-dichlorophenyl)methylamino]cyclohexan-1-ol |
| SMILES | OC1CCCCC1NCc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H17Cl2NO/c14-10-5-3-4-9(13(10)15)8-16-11-6-1-2-7-12(11)17/h3-5,11-12,16-17H,1-2,6-8H2 |
| InChIKey | PAKCGOLXPAPNLI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |