C13H16N2O — CID 115768010
2-[[(2-hydroxycyclopentyl)amino]methyl]benzonitrile (PubChem CID 115768010) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-[[(2-hydroxycyclopentyl)amino]methyl]benzonitrile.
| Compound Name | 2-[[(2-hydroxycyclopentyl)amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 115768010 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 2-[[(2-hydroxycyclopentyl)amino]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1CNC1CCCC1O |
| InChI | InChI=1S/C13H16N2O/c14-8-10-4-1-2-5-11(10)9-15-12-6-3-7-13(12)16/h1-2,4-5,12-13,15-16H,3,6-7,9H2 |
| InChIKey | OUOZSODUTYXDBV-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |