C15H20N2S — CID 113338452
2-[[(3-methylsulfanylcyclohexyl)amino]methyl]benzonitrile (PubChem CID 113338452) has the molecular formula C15H20N2S and a molecular weight of 260.41 g/mol. Its IUPAC name is 2-[[(3-methylsulfanylcyclohexyl)amino]methyl]benzonitrile.
| Compound Name | 2-[[(3-methylsulfanylcyclohexyl)amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 113338452 |
| Molecular Formula | C15H20N2S |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 2-[[(3-methylsulfanylcyclohexyl)amino]methyl]benzonitrile |
| SMILES | CSC1CCCC(NCc2ccccc2C#N)C1 |
| InChI | InChI=1S/C15H20N2S/c1-18-15-8-4-7-14(9-15)17-11-13-6-3-2-5-12(13)10-16/h2-3,5-6,14-15,17H,4,7-9,11H2,1H3 |
| InChIKey | LXBFHMBWVJHJLC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |