C15H22ClNS — CID 114122241
N-[(3-chloro-4-methylphenyl)methyl]-3-methylsulfanylcyclohexan-1-amine (PubChem CID 114122241) has the molecular formula C15H22ClNS and a molecular weight of 283.87 g/mol. Its IUPAC name is N-[(3-chloro-4-methylphenyl)methyl]-3-methylsulfanylcyclohexan-1-amine.
| Compound Name | N-[(3-chloro-4-methylphenyl)methyl]-3-methylsulfanylcyclohexan-1-amine |
|---|---|
| PubChem CID | 114122241 |
| Molecular Formula | C15H22ClNS |
| Molecular Weight | 283.87 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | N-[(3-chloro-4-methylphenyl)methyl]-3-methylsulfanylcyclohexan-1-amine |
| SMILES | CSC1CCCC(NCc2ccc(C)c(Cl)c2)C1 |
| InChI | InChI=1S/C15H22ClNS/c1-11-6-7-12(8-15(11)16)10-17-13-4-3-5-14(9-13)18-2/h6-8,13-14,17H,3-5,9-10H2,1-2H3 |
| InChIKey | RKSLKSBYKKOIBA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.87 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |