C14H19IN2 — CID 142748266
N-[(2-iodophenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine (PubChem CID 142748266) has the molecular formula C14H19IN2 and a molecular weight of 342.22 g/mol. Its IUPAC name is N-[(2-iodophenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine.
| Compound Name | N-[(2-iodophenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine |
|---|---|
| PubChem CID | 142748266 |
| Molecular Formula | C14H19IN2 |
| Molecular Weight | 342.22 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | N-[(2-iodophenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine |
| SMILES | Ic1ccccc1CNC1CN2CCC1CC2 |
| InChI | InChI=1S/C14H19IN2/c15-13-4-2-1-3-12(13)9-16-14-10-17-7-5-11(14)6-8-17/h1-4,11,14,16H,5-10H2 |
| InChIKey | OQFSJSIUSBXNSW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.22 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|