About N-[(3,5-dichloro-2-methoxyphenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride
N-[(3,5-dichloro-2-methoxyphenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride (PubChem CID 17158940) has the molecular formula C15H22Cl4N2O
and a molecular weight of 388.17 g/mol. Its IUPAC name is N-[(3,5-dichloro-2-methoxyphenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride.
Molecular Properties
| Compound Name | N-[(3,5-dichloro-2-methoxyphenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride |
| PubChem CID | 17158940 |
| Molecular Formula | C15H22Cl4N2O |
| Molecular Weight | 388.17 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | N-[(3,5-dichloro-2-methoxyphenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride |
| SMILES | COc1c(Cl)cc(Cl)cc1CNC1CN2CCC1CC2.Cl.Cl |
| InChI | InChI=1S/C15H20Cl2N2O.2ClH/c1-20-15-11(6-12(16)7-13(15)17)8-18-14-9-19-4-2-10(14)3-5-19;;/h6-7,10,14,18H,2-5,8-9H2,1H3;2*1H |
| InChIKey | UDPUJDKPPUTYPB-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.17 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(3,5-dichloro-2-methoxyphenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,5-dichloro-2-methoxyphenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride?
The IUPAC name of N-[(3,5-dichloro-2-methoxyphenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride (CID 17158940) is N-[(3,5-dichloro-2-methoxyphenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride.
What is the SMILES notation for N-[(3,5-dichloro-2-methoxyphenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride?
The canonical SMILES for N-[(3,5-dichloro-2-methoxyphenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride is COc1c(Cl)cc(Cl)cc1CNC1CN2CCC1CC2.Cl.Cl.
What is the InChIKey of N-[(3,5-dichloro-2-methoxyphenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride?
The InChIKey is UDPUJDKPPUTYPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20Cl2N2O.2ClH/c1-20-15-11(6-12(16)7-13(15)17)8-18-14-9-19-4-2-10(14)3-5-19;;/h6-7,10,14,18H,2-5,8-9H2,1H3;2*1H.
What are the key properties of N-[(3,5-dichloro-2-methoxyphenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride?
N-[(3,5-dichloro-2-methoxyphenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride has a molecular weight of 388.17 g/mol, XLogP of 4.03, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,5-dichloro-2-methoxyphenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride is sourced from PubChem (CID 17158940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).