C14H18BrClN2 — CID 83236019
N-[(3-bromo-4-chlorophenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine (PubChem CID 83236019) has the molecular formula C14H18BrClN2 and a molecular weight of 329.67 g/mol. Its IUPAC name is N-[(3-bromo-4-chlorophenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine.
| Compound Name | N-[(3-bromo-4-chlorophenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine |
|---|---|
| PubChem CID | 83236019 |
| Molecular Formula | C14H18BrClN2 |
| Molecular Weight | 329.67 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | N-[(3-bromo-4-chlorophenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine |
| SMILES | Clc1ccc(CNC2CN3CCC2CC3)cc1Br |
| InChI | InChI=1S/C14H18BrClN2/c15-12-7-10(1-2-13(12)16)8-17-14-9-18-5-3-11(14)4-6-18/h1-2,7,11,14,17H,3-6,8-9H2 |
| InChIKey | MXZMTMNEODXVCW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.67 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |