C14H20BrFN2O2S — CID 103866090
N-[(2-bromo-5-fluorophenyl)methyl]-1-ethylsulfonylpiperidin-4-amine (PubChem CID 103866090) has the molecular formula C14H20BrFN2O2S and a molecular weight of 379.30 g/mol. Its IUPAC name is N-[(2-bromo-5-fluorophenyl)methyl]-1-ethylsulfonylpiperidin-4-amine.
| Compound Name | N-[(2-bromo-5-fluorophenyl)methyl]-1-ethylsulfonylpiperidin-4-amine |
|---|---|
| PubChem CID | 103866090 |
| Molecular Formula | C14H20BrFN2O2S |
| Molecular Weight | 379.30 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | N-[(2-bromo-5-fluorophenyl)methyl]-1-ethylsulfonylpiperidin-4-amine |
| SMILES | CCS(=O)(=O)N1CCC(NCc2cc(F)ccc2Br)CC1 |
| InChI | InChI=1S/C14H20BrFN2O2S/c1-2-21(19,20)18-7-5-13(6-8-18)17-10-11-9-12(16)3-4-14(11)15/h3-4,9,13,17H,2,5-8,10H2,1H3 |
| InChIKey | MNYWULDZKNBKCI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |