C13H18BrFN2O2S — CID 43628921
N-[(2-bromo-4-fluorophenyl)methyl]-1-methylsulfonylpiperidin-4-amine (PubChem CID 43628921) has the molecular formula C13H18BrFN2O2S and a molecular weight of 365.27 g/mol. Its IUPAC name is N-[(2-bromo-4-fluorophenyl)methyl]-1-methylsulfonylpiperidin-4-amine.
| Compound Name | N-[(2-bromo-4-fluorophenyl)methyl]-1-methylsulfonylpiperidin-4-amine |
|---|---|
| PubChem CID | 43628921 |
| Molecular Formula | C13H18BrFN2O2S |
| Molecular Weight | 365.27 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | N-[(2-bromo-4-fluorophenyl)methyl]-1-methylsulfonylpiperidin-4-amine |
| SMILES | CS(=O)(=O)N1CCC(NCc2ccc(F)cc2Br)CC1 |
| InChI | InChI=1S/C13H18BrFN2O2S/c1-20(18,19)17-6-4-12(5-7-17)16-9-10-2-3-11(15)8-13(10)14/h2-3,8,12,16H,4-7,9H2,1H3 |
| InChIKey | LFOHYGPMJDWILH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |