C12H13BrFN — CID 115777600
N-[(2-bromo-5-fluorophenyl)methyl]cyclopent-3-en-1-amine (PubChem CID 115777600) has the molecular formula C12H13BrFN and a molecular weight of 270.14 g/mol. Its IUPAC name is N-[(2-bromo-5-fluorophenyl)methyl]cyclopent-3-en-1-amine.
| Compound Name | N-[(2-bromo-5-fluorophenyl)methyl]cyclopent-3-en-1-amine |
|---|---|
| PubChem CID | 115777600 |
| Molecular Formula | C12H13BrFN |
| Molecular Weight | 270.14 g/mol |
| Exact Mass | 269.02 |
| IUPAC Name | N-[(2-bromo-5-fluorophenyl)methyl]cyclopent-3-en-1-amine |
| SMILES | Fc1ccc(Br)c(CNC2CC=CC2)c1 |
| InChI | InChI=1S/C12H13BrFN/c13-12-6-5-10(14)7-9(12)8-15-11-3-1-2-4-11/h1-2,5-7,11,15H,3-4,8H2 |
| InChIKey | TXQQKZVBWMHDFK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.14 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|