C15H15BrFNO3 — CID 93444649
(1S,6R)-6-[(2-bromo-5-fluorophenyl)methylcarbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 93444649) has the molecular formula C15H15BrFNO3 and a molecular weight of 356.19 g/mol. Its IUPAC name is (1S,6R)-6-[(2-bromo-5-fluorophenyl)methylcarbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-6-[(2-bromo-5-fluorophenyl)methylcarbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 93444649 |
| Molecular Formula | C15H15BrFNO3 |
| Molecular Weight | 356.19 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | (1S,6R)-6-[(2-bromo-5-fluorophenyl)methylcarbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CC=CC[C@H]1C(=O)NCc1cc(F)ccc1Br |
| InChI | InChI=1S/C15H15BrFNO3/c16-13-6-5-10(17)7-9(13)8-18-14(19)11-3-1-2-4-12(11)15(20)21/h1-2,5-7,11-12H,3-4,8H2,(H,18,19)(H,20,21)/t11-,12+/m1/s1 |
| InChIKey | HDEUNHMDQGHBEH-NEPJUHHUSA-N |
| XLogP | 2.87 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.19 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|