C13H16BrFN2O2 — CID 66267402
N-[(2-bromo-5-fluorophenyl)methyl]-4-(methylamino)oxolane-3-carboxamide (PubChem CID 66267402) has the molecular formula C13H16BrFN2O2 and a molecular weight of 331.19 g/mol. Its IUPAC name is N-[(2-bromo-5-fluorophenyl)methyl]-4-(methylamino)oxolane-3-carboxamide.
| Compound Name | N-[(2-bromo-5-fluorophenyl)methyl]-4-(methylamino)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 66267402 |
| Molecular Formula | C13H16BrFN2O2 |
| Molecular Weight | 331.19 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | N-[(2-bromo-5-fluorophenyl)methyl]-4-(methylamino)oxolane-3-carboxamide |
| SMILES | CNC1COCC1C(=O)NCc1cc(F)ccc1Br |
| InChI | InChI=1S/C13H16BrFN2O2/c1-16-12-7-19-6-10(12)13(18)17-5-8-4-9(15)2-3-11(8)14/h2-4,10,12,16H,5-7H2,1H3,(H,17,18) |
| InChIKey | WHLBVKLCNXJECR-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.19 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |