About 4-(methylamino)-N-(1,2-oxazol-5-ylmethyl)oxolane-3-carboxamide
4-(methylamino)-N-(1,2-oxazol-5-ylmethyl)oxolane-3-carboxamide (PubChem CID 106417047) has the molecular formula C10H15N3O3
and a molecular weight of 225.25 g/mol. Its IUPAC name is 4-(methylamino)-N-(1,2-oxazol-5-ylmethyl)oxolane-3-carboxamide.
Molecular Properties
| Compound Name | 4-(methylamino)-N-(1,2-oxazol-5-ylmethyl)oxolane-3-carboxamide |
| PubChem CID | 106417047 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 4-(methylamino)-N-(1,2-oxazol-5-ylmethyl)oxolane-3-carboxamide |
| SMILES | CNC1COCC1C(=O)NCc1ccno1 |
| InChI | InChI=1S/C10H15N3O3/c1-11-9-6-15-5-8(9)10(14)12-4-7-2-3-13-16-7/h2-3,8-9,11H,4-6H2,1H3,(H,12,14) |
| InChIKey | VAQZIUXIKARRGS-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(methylamino)-N-(1,2-oxazol-5-ylmethyl)oxolane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(methylamino)-N-(1,2-oxazol-5-ylmethyl)oxolane-3-carboxamide?
The IUPAC name of 4-(methylamino)-N-(1,2-oxazol-5-ylmethyl)oxolane-3-carboxamide (CID 106417047) is 4-(methylamino)-N-(1,2-oxazol-5-ylmethyl)oxolane-3-carboxamide.
What is the SMILES notation for 4-(methylamino)-N-(1,2-oxazol-5-ylmethyl)oxolane-3-carboxamide?
The canonical SMILES for 4-(methylamino)-N-(1,2-oxazol-5-ylmethyl)oxolane-3-carboxamide is CNC1COCC1C(=O)NCc1ccno1.
What is the InChIKey of 4-(methylamino)-N-(1,2-oxazol-5-ylmethyl)oxolane-3-carboxamide?
The InChIKey is VAQZIUXIKARRGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O3/c1-11-9-6-15-5-8(9)10(14)12-4-7-2-3-13-16-7/h2-3,8-9,11H,4-6H2,1H3,(H,12,14).
What are the key properties of 4-(methylamino)-N-(1,2-oxazol-5-ylmethyl)oxolane-3-carboxamide?
4-(methylamino)-N-(1,2-oxazol-5-ylmethyl)oxolane-3-carboxamide has a molecular weight of 225.25 g/mol, XLogP of -0.47, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(methylamino)-N-(1,2-oxazol-5-ylmethyl)oxolane-3-carboxamide is sourced from PubChem (CID 106417047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).