C15H19BrF2N2O — CID 43763481
N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-1-azabicyclo[2.2.2]octan-3-amine (PubChem CID 43763481) has the molecular formula C15H19BrF2N2O and a molecular weight of 361.23 g/mol. Its IUPAC name is N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-1-azabicyclo[2.2.2]octan-3-amine.
| Compound Name | N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-1-azabicyclo[2.2.2]octan-3-amine |
|---|---|
| PubChem CID | 43763481 |
| Molecular Formula | C15H19BrF2N2O |
| Molecular Weight | 361.23 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-1-azabicyclo[2.2.2]octan-3-amine |
| SMILES | FC(F)Oc1ccc(Br)cc1CNC1CN2CCC1CC2 |
| InChI | InChI=1S/C15H19BrF2N2O/c16-12-1-2-14(21-15(17)18)11(7-12)8-19-13-9-20-5-3-10(13)4-6-20/h1-2,7,10,13,15,19H,3-6,8-9H2 |
| InChIKey | MIVYAAKGXSABAU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.23 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |