C14H19BrF2N2O — CID 43223597
N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-1-methylpiperidin-4-amine (PubChem CID 43223597) has the molecular formula C14H19BrF2N2O and a molecular weight of 349.22 g/mol. Its IUPAC name is N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-1-methylpiperidin-4-amine.
| Compound Name | N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-1-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 43223597 |
| Molecular Formula | C14H19BrF2N2O |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]-1-methylpiperidin-4-amine |
| SMILES | CN1CCC(NCc2cc(Br)ccc2OC(F)F)CC1 |
| InChI | InChI=1S/C14H19BrF2N2O/c1-19-6-4-12(5-7-19)18-9-10-8-11(15)2-3-13(10)20-14(16)17/h2-3,8,12,14,18H,4-7,9H2,1H3 |
| InChIKey | XYCFUVOVARJHGQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |