C15H18BrF2NO3 — CID 120509911
4-[[5-bromo-2-(difluoromethoxy)phenyl]methylamino]cyclohexane-1-carboxylic acid (PubChem CID 120509911) has the molecular formula C15H18BrF2NO3 and a molecular weight of 378.21 g/mol. Its IUPAC name is 4-[[5-bromo-2-(difluoromethoxy)phenyl]methylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[5-bromo-2-(difluoromethoxy)phenyl]methylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120509911 |
| Molecular Formula | C15H18BrF2NO3 |
| Molecular Weight | 378.21 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | 4-[[5-bromo-2-(difluoromethoxy)phenyl]methylamino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(NCc2cc(Br)ccc2OC(F)F)CC1 |
| InChI | InChI=1S/C15H18BrF2NO3/c16-11-3-6-13(22-15(17)18)10(7-11)8-19-12-4-1-9(2-5-12)14(20)21/h3,6-7,9,12,15,19H,1-2,4-5,8H2,(H,20,21) |
| InChIKey | FCUVTAJFABRSPY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.21 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |