C16H21F2NO4 — CID 120509745
4-[[2-(difluoromethoxy)-5-methoxyphenyl]methylamino]cyclohexane-1-carboxylic acid (PubChem CID 120509745) has the molecular formula C16H21F2NO4 and a molecular weight of 329.34 g/mol. Its IUPAC name is 4-[[2-(difluoromethoxy)-5-methoxyphenyl]methylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[2-(difluoromethoxy)-5-methoxyphenyl]methylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120509745 |
| Molecular Formula | C16H21F2NO4 |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 4-[[2-(difluoromethoxy)-5-methoxyphenyl]methylamino]cyclohexane-1-carboxylic acid |
| SMILES | COc1ccc(OC(F)F)c(CNC2CCC(C(=O)O)CC2)c1 |
| InChI | InChI=1S/C16H21F2NO4/c1-22-13-6-7-14(23-16(17)18)11(8-13)9-19-12-4-2-10(3-5-12)15(20)21/h6-8,10,12,16,19H,2-5,9H2,1H3,(H,20,21) |
| InChIKey | YOSIRQUMGCNETE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |