C14H17BrF2N2O2 — CID 119766513
3-amino-N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]cyclopentane-1-carboxamide (PubChem CID 119766513) has the molecular formula C14H17BrF2N2O2 and a molecular weight of 363.20 g/mol. Its IUPAC name is 3-amino-N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]cyclopentane-1-carboxamide.
| Compound Name | 3-amino-N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 119766513 |
| Molecular Formula | C14H17BrF2N2O2 |
| Molecular Weight | 363.20 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | 3-amino-N-[[5-bromo-2-(difluoromethoxy)phenyl]methyl]cyclopentane-1-carboxamide |
| SMILES | NC1CCC(C(=O)NCc2cc(Br)ccc2OC(F)F)C1 |
| InChI | InChI=1S/C14H17BrF2N2O2/c15-10-2-4-12(21-14(16)17)9(5-10)7-19-13(20)8-1-3-11(18)6-8/h2,4-5,8,11,14H,1,3,6-7,18H2,(H,19,20) |
| InChIKey | VMOIYCSCXBPNTF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.20 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |